C15H25NO7 — CID 165157175
triethyl 2-[(2S)-morpholin-2-yl]ethane-1,1,1-tricarboxylate (PubChem CID 165157175) has the molecular formula C15H25NO7 and a molecular weight of 331.37 g/mol. Its IUPAC name is triethyl 2-[(2S)-morpholin-2-yl]ethane-1,1,1-tricarboxylate.
| Compound Name | triethyl 2-[(2S)-morpholin-2-yl]ethane-1,1,1-tricarboxylate |
|---|---|
| PubChem CID | 165157175 |
| Molecular Formula | C15H25NO7 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | triethyl 2-[(2S)-morpholin-2-yl]ethane-1,1,1-tricarboxylate |
| SMILES | CCOC(=O)C(C[C@H]1CNCCO1)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C15H25NO7/c1-4-20-12(17)15(13(18)21-5-2,14(19)22-6-3)9-11-10-16-7-8-23-11/h11,16H,4-10H2,1-3H3/t11-/m0/s1 |
| InChIKey | FCVMTZQBJKJDDC-NSHDSACASA-N |
| XLogP | 0.04 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|