C8H16N2O3 — CID 114469366
morpholin-2-ylmethyl N,N-dimethylcarbamate (PubChem CID 114469366) has the molecular formula C8H16N2O3 and a molecular weight of 188.23 g/mol. Its IUPAC name is morpholin-2-ylmethyl N,N-dimethylcarbamate.
| Compound Name | morpholin-2-ylmethyl N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 114469366 |
| Molecular Formula | C8H16N2O3 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | morpholin-2-ylmethyl N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)OCC1CNCCO1 |
| InChI | InChI=1S/C8H16N2O3/c1-10(2)8(11)13-6-7-5-9-3-4-12-7/h7,9H,3-6H2,1-2H3 |
| InChIKey | FEYRNDGVFHZEMW-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |