About morpholin-2-ylmethyl N-(oxolan-3-yl)carbamate
morpholin-2-ylmethyl N-(oxolan-3-yl)carbamate (PubChem CID 114469375) has the molecular formula C10H18N2O4
and a molecular weight of 230.26 g/mol. Its IUPAC name is morpholin-2-ylmethyl N-(oxolan-3-yl)carbamate.
Molecular Properties
| Compound Name | morpholin-2-ylmethyl N-(oxolan-3-yl)carbamate |
| PubChem CID | 114469375 |
| Molecular Formula | C10H18N2O4 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | morpholin-2-ylmethyl N-(oxolan-3-yl)carbamate |
| SMILES | O=C(NC1CCOC1)OCC1CNCCO1 |
| InChI | InChI=1S/C10H18N2O4/c13-10(12-8-1-3-14-6-8)16-7-9-5-11-2-4-15-9/h8-9,11H,1-7H2,(H,12,13) |
| InChIKey | OKMTVTUIWWCBCX-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze morpholin-2-ylmethyl N-(oxolan-3-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of morpholin-2-ylmethyl N-(oxolan-3-yl)carbamate?
The IUPAC name of morpholin-2-ylmethyl N-(oxolan-3-yl)carbamate (CID 114469375) is morpholin-2-ylmethyl N-(oxolan-3-yl)carbamate.
What is the SMILES notation for morpholin-2-ylmethyl N-(oxolan-3-yl)carbamate?
The canonical SMILES for morpholin-2-ylmethyl N-(oxolan-3-yl)carbamate is O=C(NC1CCOC1)OCC1CNCCO1.
What is the InChIKey of morpholin-2-ylmethyl N-(oxolan-3-yl)carbamate?
The InChIKey is OKMTVTUIWWCBCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O4/c13-10(12-8-1-3-14-6-8)16-7-9-5-11-2-4-15-9/h8-9,11H,1-7H2,(H,12,13).
What are the key properties of morpholin-2-ylmethyl N-(oxolan-3-yl)carbamate?
morpholin-2-ylmethyl N-(oxolan-3-yl)carbamate has a molecular weight of 230.26 g/mol, XLogP of -0.51, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for morpholin-2-ylmethyl N-(oxolan-3-yl)carbamate is sourced from PubChem (CID 114469375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).