About morpholin-2-ylmethyl benzoate;hydrochloride
morpholin-2-ylmethyl benzoate;hydrochloride (PubChem CID 19777235) has the molecular formula C12H16ClNO3
and a molecular weight of 257.72 g/mol. Its IUPAC name is morpholin-2-ylmethyl benzoate;hydrochloride.
Molecular Properties
| Compound Name | morpholin-2-ylmethyl benzoate;hydrochloride |
| PubChem CID | 19777235 |
| Molecular Formula | C12H16ClNO3 |
| Molecular Weight | 257.72 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | morpholin-2-ylmethyl benzoate;hydrochloride |
| SMILES | Cl.O=C(OCC1CNCCO1)c1ccccc1 |
| InChI | InChI=1S/C12H15NO3.ClH/c14-12(10-4-2-1-3-5-10)16-9-11-8-13-6-7-15-11;/h1-5,11,13H,6-9H2;1H |
| InChIKey | YKNLMTPADGYDKU-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.72 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze morpholin-2-ylmethyl benzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of morpholin-2-ylmethyl benzoate;hydrochloride?
The IUPAC name of morpholin-2-ylmethyl benzoate;hydrochloride (CID 19777235) is morpholin-2-ylmethyl benzoate;hydrochloride.
What is the SMILES notation for morpholin-2-ylmethyl benzoate;hydrochloride?
The canonical SMILES for morpholin-2-ylmethyl benzoate;hydrochloride is Cl.O=C(OCC1CNCCO1)c1ccccc1.
What is the InChIKey of morpholin-2-ylmethyl benzoate;hydrochloride?
The InChIKey is YKNLMTPADGYDKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO3.ClH/c14-12(10-4-2-1-3-5-10)16-9-11-8-13-6-7-15-11;/h1-5,11,13H,6-9H2;1H.
What are the key properties of morpholin-2-ylmethyl benzoate;hydrochloride?
morpholin-2-ylmethyl benzoate;hydrochloride has a molecular weight of 257.72 g/mol, XLogP of 1.25, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for morpholin-2-ylmethyl benzoate;hydrochloride is sourced from PubChem (CID 19777235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).