About bis(oxolan-2-ylmethyl) butanedioate;oxolan-2-ylmethyl benzoate
bis(oxolan-2-ylmethyl) butanedioate;oxolan-2-ylmethyl benzoate (PubChem CID 67831288) has the molecular formula C26H36O9
and a molecular weight of 492.57 g/mol. Its IUPAC name is bis(oxolan-2-ylmethyl) butanedioate;oxolan-2-ylmethyl benzoate.
Molecular Properties
| Compound Name | bis(oxolan-2-ylmethyl) butanedioate;oxolan-2-ylmethyl benzoate |
| PubChem CID | 67831288 |
| Molecular Formula | C26H36O9 |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | bis(oxolan-2-ylmethyl) butanedioate;oxolan-2-ylmethyl benzoate |
| SMILES | O=C(CCC(=O)OCC1CCCO1)OCC1CCCO1.O=C(OCC1CCCO1)c1ccccc1 |
| InChI | InChI=1S/C14H22O6.C12H14O3/c15-13(19-9-11-3-1-7-17-11)5-6-14(16)20-10-12-4-2-8-18-12;13-12(10-5-2-1-3-6-10)15-9-11-7-4-8-14-11/h11-12H,1-10H2;1-3,5-6,11H,4,7-9H2 |
| InChIKey | NJJPNNCKJBDGAF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze bis(oxolan-2-ylmethyl) butanedioate;oxolan-2-ylmethyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(oxolan-2-ylmethyl) butanedioate;oxolan-2-ylmethyl benzoate?
The IUPAC name of bis(oxolan-2-ylmethyl) butanedioate;oxolan-2-ylmethyl benzoate (CID 67831288) is bis(oxolan-2-ylmethyl) butanedioate;oxolan-2-ylmethyl benzoate.
What is the SMILES notation for bis(oxolan-2-ylmethyl) butanedioate;oxolan-2-ylmethyl benzoate?
The canonical SMILES for bis(oxolan-2-ylmethyl) butanedioate;oxolan-2-ylmethyl benzoate is O=C(CCC(=O)OCC1CCCO1)OCC1CCCO1.O=C(OCC1CCCO1)c1ccccc1.
What is the InChIKey of bis(oxolan-2-ylmethyl) butanedioate;oxolan-2-ylmethyl benzoate?
The InChIKey is NJJPNNCKJBDGAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O6.C12H14O3/c15-13(19-9-11-3-1-7-17-11)5-6-14(16)20-10-12-4-2-8-18-12;13-12(10-5-2-1-3-6-10)15-9-11-7-4-8-14-11/h11-12H,1-10H2;1-3,5-6,11H,4,7-9H2.
What are the key properties of bis(oxolan-2-ylmethyl) butanedioate;oxolan-2-ylmethyl benzoate?
bis(oxolan-2-ylmethyl) butanedioate;oxolan-2-ylmethyl benzoate has a molecular weight of 492.57 g/mol, XLogP of 3.23, 10 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for bis(oxolan-2-ylmethyl) butanedioate;oxolan-2-ylmethyl benzoate is sourced from PubChem (CID 67831288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).