About benzyl 2-morpholin-2-ylacetate
benzyl 2-morpholin-2-ylacetate (PubChem CID 66434624) has the molecular formula C13H17NO3
and a molecular weight of 235.28 g/mol. Its IUPAC name is benzyl 2-morpholin-2-ylacetate.
Molecular Properties
| Compound Name | benzyl 2-morpholin-2-ylacetate |
| PubChem CID | 66434624 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | benzyl 2-morpholin-2-ylacetate |
| SMILES | O=C(CC1CNCCO1)OCc1ccccc1 |
| InChI | InChI=1S/C13H17NO3/c15-13(8-12-9-14-6-7-16-12)17-10-11-4-2-1-3-5-11/h1-5,12,14H,6-10H2 |
| InChIKey | KKEYDLABAKFZIQ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze benzyl 2-morpholin-2-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-morpholin-2-ylacetate?
The IUPAC name of benzyl 2-morpholin-2-ylacetate (CID 66434624) is benzyl 2-morpholin-2-ylacetate.
What is the SMILES notation for benzyl 2-morpholin-2-ylacetate?
The canonical SMILES for benzyl 2-morpholin-2-ylacetate is O=C(CC1CNCCO1)OCc1ccccc1.
What is the InChIKey of benzyl 2-morpholin-2-ylacetate?
The InChIKey is KKEYDLABAKFZIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO3/c15-13(8-12-9-14-6-7-16-12)17-10-11-4-2-1-3-5-11/h1-5,12,14H,6-10H2.
What are the key properties of benzyl 2-morpholin-2-ylacetate?
benzyl 2-morpholin-2-ylacetate has a molecular weight of 235.28 g/mol, XLogP of 1.11, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-morpholin-2-ylacetate is sourced from PubChem (CID 66434624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).