C13H20O5 — CID 175401857
ethyl 3-(oxiran-2-yl)-2,2-bis(oxiran-2-ylmethyl)propanoate (PubChem CID 175401857) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is ethyl 3-(oxiran-2-yl)-2,2-bis(oxiran-2-ylmethyl)propanoate.
| Compound Name | ethyl 3-(oxiran-2-yl)-2,2-bis(oxiran-2-ylmethyl)propanoate |
|---|---|
| PubChem CID | 175401857 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | ethyl 3-(oxiran-2-yl)-2,2-bis(oxiran-2-ylmethyl)propanoate |
| SMILES | CCOC(=O)C(CC1CO1)(CC1CO1)CC1CO1 |
| InChI | InChI=1S/C13H20O5/c1-2-15-12(14)13(3-9-6-16-9,4-10-7-17-10)5-11-8-18-11/h9-11H,2-8H2,1H3 |
| InChIKey | BJWZJSWPLIXGJC-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 63.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|