C9H20N2O2 — CID 144883589
N,N-dimethylmorpholine-2-carboxamide;ethane (PubChem CID 144883589) has the molecular formula C9H20N2O2 and a molecular weight of 188.27 g/mol. Its IUPAC name is N,N-dimethylmorpholine-2-carboxamide;ethane.
| Compound Name | N,N-dimethylmorpholine-2-carboxamide;ethane |
|---|---|
| PubChem CID | 144883589 |
| Molecular Formula | C9H20N2O2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.15 |
| IUPAC Name | N,N-dimethylmorpholine-2-carboxamide;ethane |
| SMILES | CC.CN(C)C(=O)C1CNCCO1 |
| InChI | InChI=1S/C7H14N2O2.C2H6/c1-9(2)7(10)6-5-8-3-4-11-6;1-2/h6,8H,3-5H2,1-2H3;1-2H3 |
| InChIKey | LRFULFXDGLTHGH-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |