About cyclopentyl piperidine-3-carboxylate
cyclopentyl piperidine-3-carboxylate (PubChem CID 61278605) has the molecular formula C11H19NO2
and a molecular weight of 197.28 g/mol. Its IUPAC name is cyclopentyl piperidine-3-carboxylate.
Molecular Properties
| Compound Name | cyclopentyl piperidine-3-carboxylate |
| PubChem CID | 61278605 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | cyclopentyl piperidine-3-carboxylate |
| SMILES | O=C(OC1CCCC1)C1CCCNC1 |
| InChI | InChI=1S/C11H19NO2/c13-11(9-4-3-7-12-8-9)14-10-5-1-2-6-10/h9-10,12H,1-8H2 |
| InChIKey | WXMPDXYSXAPGHD-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclopentyl piperidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentyl piperidine-3-carboxylate?
The IUPAC name of cyclopentyl piperidine-3-carboxylate (CID 61278605) is cyclopentyl piperidine-3-carboxylate.
What is the SMILES notation for cyclopentyl piperidine-3-carboxylate?
The canonical SMILES for cyclopentyl piperidine-3-carboxylate is O=C(OC1CCCC1)C1CCCNC1.
What is the InChIKey of cyclopentyl piperidine-3-carboxylate?
The InChIKey is WXMPDXYSXAPGHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO2/c13-11(9-4-3-7-12-8-9)14-10-5-1-2-6-10/h9-10,12H,1-8H2.
What are the key properties of cyclopentyl piperidine-3-carboxylate?
cyclopentyl piperidine-3-carboxylate has a molecular weight of 197.28 g/mol, XLogP of 1.47, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentyl piperidine-3-carboxylate is sourced from PubChem (CID 61278605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).