About [(3S)-pyrrolidin-3-yl] (3S)-pyrrolidine-3-carboxylate
[(3S)-pyrrolidin-3-yl] (3S)-pyrrolidine-3-carboxylate (PubChem CID 140571611) has the molecular formula C9H16N2O2
and a molecular weight of 184.24 g/mol. Its IUPAC name is [(3S)-pyrrolidin-3-yl] (3S)-pyrrolidine-3-carboxylate.
Molecular Properties
| Compound Name | [(3S)-pyrrolidin-3-yl] (3S)-pyrrolidine-3-carboxylate |
| PubChem CID | 140571611 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | [(3S)-pyrrolidin-3-yl] (3S)-pyrrolidine-3-carboxylate |
| SMILES | O=C(O[C@H]1CCNC1)[C@H]1CCNC1 |
| InChI | InChI=1S/C9H16N2O2/c12-9(7-1-3-10-5-7)13-8-2-4-11-6-8/h7-8,10-11H,1-6H2/t7-,8-/m0/s1 |
| InChIKey | URPPIYBSYUIXBY-YUMQZZPRSA-N |
| XLogP | -0.50 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(3S)-pyrrolidin-3-yl] (3S)-pyrrolidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-pyrrolidin-3-yl] (3S)-pyrrolidine-3-carboxylate?
The IUPAC name of [(3S)-pyrrolidin-3-yl] (3S)-pyrrolidine-3-carboxylate (CID 140571611) is [(3S)-pyrrolidin-3-yl] (3S)-pyrrolidine-3-carboxylate.
What is the SMILES notation for [(3S)-pyrrolidin-3-yl] (3S)-pyrrolidine-3-carboxylate?
The canonical SMILES for [(3S)-pyrrolidin-3-yl] (3S)-pyrrolidine-3-carboxylate is O=C(O[C@H]1CCNC1)[C@H]1CCNC1.
What is the InChIKey of [(3S)-pyrrolidin-3-yl] (3S)-pyrrolidine-3-carboxylate?
The InChIKey is URPPIYBSYUIXBY-YUMQZZPRSA-N. The full InChI is InChI=1S/C9H16N2O2/c12-9(7-1-3-10-5-7)13-8-2-4-11-6-8/h7-8,10-11H,1-6H2/t7-,8-/m0/s1.
What are the key properties of [(3S)-pyrrolidin-3-yl] (3S)-pyrrolidine-3-carboxylate?
[(3S)-pyrrolidin-3-yl] (3S)-pyrrolidine-3-carboxylate has a molecular weight of 184.24 g/mol, XLogP of -0.50, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-pyrrolidin-3-yl] (3S)-pyrrolidine-3-carboxylate is sourced from PubChem (CID 140571611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).