About [(3R)-pyrrolidin-3-yl] carbamate;hydrochloride
[(3R)-pyrrolidin-3-yl] carbamate;hydrochloride (PubChem CID 67938211) has the molecular formula C5H11ClN2O2
and a molecular weight of 166.61 g/mol. Its IUPAC name is [(3R)-pyrrolidin-3-yl] carbamate;hydrochloride.
Molecular Properties
| Compound Name | [(3R)-pyrrolidin-3-yl] carbamate;hydrochloride |
| PubChem CID | 67938211 |
| Molecular Formula | C5H11ClN2O2 |
| Molecular Weight | 166.61 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | [(3R)-pyrrolidin-3-yl] carbamate;hydrochloride |
| SMILES | Cl.NC(=O)O[C@@H]1CCNC1 |
| InChI | InChI=1S/C5H10N2O2.ClH/c6-5(8)9-4-1-2-7-3-4;/h4,7H,1-3H2,(H2,6,8);1H/t4-;/m1./s1 |
| InChIKey | PFXNVVITKQXZQE-PGMHMLKASA-N |
| XLogP | -0.13 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.61 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(3R)-pyrrolidin-3-yl] carbamate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-pyrrolidin-3-yl] carbamate;hydrochloride?
The IUPAC name of [(3R)-pyrrolidin-3-yl] carbamate;hydrochloride (CID 67938211) is [(3R)-pyrrolidin-3-yl] carbamate;hydrochloride.
What is the SMILES notation for [(3R)-pyrrolidin-3-yl] carbamate;hydrochloride?
The canonical SMILES for [(3R)-pyrrolidin-3-yl] carbamate;hydrochloride is Cl.NC(=O)O[C@@H]1CCNC1.
What is the InChIKey of [(3R)-pyrrolidin-3-yl] carbamate;hydrochloride?
The InChIKey is PFXNVVITKQXZQE-PGMHMLKASA-N. The full InChI is InChI=1S/C5H10N2O2.ClH/c6-5(8)9-4-1-2-7-3-4;/h4,7H,1-3H2,(H2,6,8);1H/t4-;/m1./s1.
What are the key properties of [(3R)-pyrrolidin-3-yl] carbamate;hydrochloride?
[(3R)-pyrrolidin-3-yl] carbamate;hydrochloride has a molecular weight of 166.61 g/mol, XLogP of -0.13, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-pyrrolidin-3-yl] carbamate;hydrochloride is sourced from PubChem (CID 67938211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).