About pyrrolidin-3-yl pyridine-4-carboxylate;hydrochloride
pyrrolidin-3-yl pyridine-4-carboxylate;hydrochloride (PubChem CID 53409827) has the molecular formula C10H13ClN2O2
and a molecular weight of 228.68 g/mol. Its IUPAC name is pyrrolidin-3-yl pyridine-4-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | pyrrolidin-3-yl pyridine-4-carboxylate;hydrochloride |
| PubChem CID | 53409827 |
| Molecular Formula | C10H13ClN2O2 |
| Molecular Weight | 228.68 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | pyrrolidin-3-yl pyridine-4-carboxylate;hydrochloride |
| SMILES | Cl.O=C(OC1CCNC1)c1ccncc1 |
| InChI | InChI=1S/C10H12N2O2.ClH/c13-10(8-1-4-11-5-2-8)14-9-3-6-12-7-9;/h1-2,4-5,9,12H,3,6-7H2;1H |
| InChIKey | AZCZYYYGRGACFQ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.68 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pyrrolidin-3-yl pyridine-4-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolidin-3-yl pyridine-4-carboxylate;hydrochloride?
The IUPAC name of pyrrolidin-3-yl pyridine-4-carboxylate;hydrochloride (CID 53409827) is pyrrolidin-3-yl pyridine-4-carboxylate;hydrochloride.
What is the SMILES notation for pyrrolidin-3-yl pyridine-4-carboxylate;hydrochloride?
The canonical SMILES for pyrrolidin-3-yl pyridine-4-carboxylate;hydrochloride is Cl.O=C(OC1CCNC1)c1ccncc1.
What is the InChIKey of pyrrolidin-3-yl pyridine-4-carboxylate;hydrochloride?
The InChIKey is AZCZYYYGRGACFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O2.ClH/c13-10(8-1-4-11-5-2-8)14-9-3-6-12-7-9;/h1-2,4-5,9,12H,3,6-7H2;1H.
What are the key properties of pyrrolidin-3-yl pyridine-4-carboxylate;hydrochloride?
pyrrolidin-3-yl pyridine-4-carboxylate;hydrochloride has a molecular weight of 228.68 g/mol, XLogP of 1.02, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolidin-3-yl pyridine-4-carboxylate;hydrochloride is sourced from PubChem (CID 53409827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).