About pyrrolidin-3-yl 4-chloropyridine-2-carboxylate;hydrochloride
pyrrolidin-3-yl 4-chloropyridine-2-carboxylate;hydrochloride (PubChem CID 56829440) has the molecular formula C10H12Cl2N2O2
and a molecular weight of 263.12 g/mol. Its IUPAC name is pyrrolidin-3-yl 4-chloropyridine-2-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | pyrrolidin-3-yl 4-chloropyridine-2-carboxylate;hydrochloride |
| PubChem CID | 56829440 |
| Molecular Formula | C10H12Cl2N2O2 |
| Molecular Weight | 263.12 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | pyrrolidin-3-yl 4-chloropyridine-2-carboxylate;hydrochloride |
| SMILES | Cl.O=C(OC1CCNC1)c1cc(Cl)ccn1 |
| InChI | InChI=1S/C10H11ClN2O2.ClH/c11-7-1-4-13-9(5-7)10(14)15-8-2-3-12-6-8;/h1,4-5,8,12H,2-3,6H2;1H |
| InChIKey | FEAICCGHTUEXGO-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.12 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pyrrolidin-3-yl 4-chloropyridine-2-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolidin-3-yl 4-chloropyridine-2-carboxylate;hydrochloride?
The IUPAC name of pyrrolidin-3-yl 4-chloropyridine-2-carboxylate;hydrochloride (CID 56829440) is pyrrolidin-3-yl 4-chloropyridine-2-carboxylate;hydrochloride.
What is the SMILES notation for pyrrolidin-3-yl 4-chloropyridine-2-carboxylate;hydrochloride?
The canonical SMILES for pyrrolidin-3-yl 4-chloropyridine-2-carboxylate;hydrochloride is Cl.O=C(OC1CCNC1)c1cc(Cl)ccn1.
What is the InChIKey of pyrrolidin-3-yl 4-chloropyridine-2-carboxylate;hydrochloride?
The InChIKey is FEAICCGHTUEXGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClN2O2.ClH/c11-7-1-4-13-9(5-7)10(14)15-8-2-3-12-6-8;/h1,4-5,8,12H,2-3,6H2;1H.
What are the key properties of pyrrolidin-3-yl 4-chloropyridine-2-carboxylate;hydrochloride?
pyrrolidin-3-yl 4-chloropyridine-2-carboxylate;hydrochloride has a molecular weight of 263.12 g/mol, XLogP of 1.68, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolidin-3-yl 4-chloropyridine-2-carboxylate;hydrochloride is sourced from PubChem (CID 56829440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).