About pyrrolidin-3-yl 4-methoxybenzoate;hydrochloride
pyrrolidin-3-yl 4-methoxybenzoate;hydrochloride (PubChem CID 53409824) has the molecular formula C12H16ClNO3
and a molecular weight of 257.72 g/mol. Its IUPAC name is pyrrolidin-3-yl 4-methoxybenzoate;hydrochloride.
Molecular Properties
| Compound Name | pyrrolidin-3-yl 4-methoxybenzoate;hydrochloride |
| PubChem CID | 53409824 |
| Molecular Formula | C12H16ClNO3 |
| Molecular Weight | 257.72 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | pyrrolidin-3-yl 4-methoxybenzoate;hydrochloride |
| SMILES | COc1ccc(C(=O)OC2CCNC2)cc1.Cl |
| InChI | InChI=1S/C12H15NO3.ClH/c1-15-10-4-2-9(3-5-10)12(14)16-11-6-7-13-8-11;/h2-5,11,13H,6-8H2,1H3;1H |
| InChIKey | ZLRRTIJSRDJHDD-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.72 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pyrrolidin-3-yl 4-methoxybenzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolidin-3-yl 4-methoxybenzoate;hydrochloride?
The IUPAC name of pyrrolidin-3-yl 4-methoxybenzoate;hydrochloride (CID 53409824) is pyrrolidin-3-yl 4-methoxybenzoate;hydrochloride.
What is the SMILES notation for pyrrolidin-3-yl 4-methoxybenzoate;hydrochloride?
The canonical SMILES for pyrrolidin-3-yl 4-methoxybenzoate;hydrochloride is COc1ccc(C(=O)OC2CCNC2)cc1.Cl.
What is the InChIKey of pyrrolidin-3-yl 4-methoxybenzoate;hydrochloride?
The InChIKey is ZLRRTIJSRDJHDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO3.ClH/c1-15-10-4-2-9(3-5-10)12(14)16-11-6-7-13-8-11;/h2-5,11,13H,6-8H2,1H3;1H.
What are the key properties of pyrrolidin-3-yl 4-methoxybenzoate;hydrochloride?
pyrrolidin-3-yl 4-methoxybenzoate;hydrochloride has a molecular weight of 257.72 g/mol, XLogP of 1.64, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolidin-3-yl 4-methoxybenzoate;hydrochloride is sourced from PubChem (CID 53409824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).