About [(3S,4S)-4-phenylpiperidin-3-yl] 4-(4-methoxyphenyl)benzoate
[(3S,4S)-4-phenylpiperidin-3-yl] 4-(4-methoxyphenyl)benzoate (PubChem CID 59674874) has the molecular formula C25H25NO3
and a molecular weight of 387.48 g/mol. Its IUPAC name is [(3S,4S)-4-phenylpiperidin-3-yl] 4-(4-methoxyphenyl)benzoate.
Molecular Properties
| Compound Name | [(3S,4S)-4-phenylpiperidin-3-yl] 4-(4-methoxyphenyl)benzoate |
| PubChem CID | 59674874 |
| Molecular Formula | C25H25NO3 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | [(3S,4S)-4-phenylpiperidin-3-yl] 4-(4-methoxyphenyl)benzoate |
| SMILES | COc1ccc(-c2ccc(C(=O)O[C@@H]3CNCC[C@H]3c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C25H25NO3/c1-28-22-13-11-19(12-14-22)18-7-9-21(10-8-18)25(27)29-24-17-26-16-15-23(24)20-5-3-2-4-6-20/h2-14,23-24,26H,15-17H2,1H3/t23-,24+/m0/s1 |
| InChIKey | FDIRDNLBRJOQQZ-BJKOFHAPSA-N |
| XLogP | 4.66 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(3S,4S)-4-phenylpiperidin-3-yl] 4-(4-methoxyphenyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,4S)-4-phenylpiperidin-3-yl] 4-(4-methoxyphenyl)benzoate?
The IUPAC name of [(3S,4S)-4-phenylpiperidin-3-yl] 4-(4-methoxyphenyl)benzoate (CID 59674874) is [(3S,4S)-4-phenylpiperidin-3-yl] 4-(4-methoxyphenyl)benzoate.
What is the SMILES notation for [(3S,4S)-4-phenylpiperidin-3-yl] 4-(4-methoxyphenyl)benzoate?
The canonical SMILES for [(3S,4S)-4-phenylpiperidin-3-yl] 4-(4-methoxyphenyl)benzoate is COc1ccc(-c2ccc(C(=O)O[C@@H]3CNCC[C@H]3c3ccccc3)cc2)cc1.
What is the InChIKey of [(3S,4S)-4-phenylpiperidin-3-yl] 4-(4-methoxyphenyl)benzoate?
The InChIKey is FDIRDNLBRJOQQZ-BJKOFHAPSA-N. The full InChI is InChI=1S/C25H25NO3/c1-28-22-13-11-19(12-14-22)18-7-9-21(10-8-18)25(27)29-24-17-26-16-15-23(24)20-5-3-2-4-6-20/h2-14,23-24,26H,15-17H2,1H3/t23-,24+/m0/s1.
What are the key properties of [(3S,4S)-4-phenylpiperidin-3-yl] 4-(4-methoxyphenyl)benzoate?
[(3S,4S)-4-phenylpiperidin-3-yl] 4-(4-methoxyphenyl)benzoate has a molecular weight of 387.48 g/mol, XLogP of 4.66, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,4S)-4-phenylpiperidin-3-yl] 4-(4-methoxyphenyl)benzoate is sourced from PubChem (CID 59674874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).