C29H33N3O3 — CID 45137554
[(4R)-3-[4-(4-methoxyphenyl)piperazin-1-yl]piperidin-4-yl] 3-phenylbenzoate (PubChem CID 45137554) has the molecular formula C29H33N3O3 and a molecular weight of 471.60 g/mol. Its IUPAC name is [(4R)-3-[4-(4-methoxyphenyl)piperazin-1-yl]piperidin-4-yl] 3-phenylbenzoate.
| Compound Name | [(4R)-3-[4-(4-methoxyphenyl)piperazin-1-yl]piperidin-4-yl] 3-phenylbenzoate |
|---|---|
| PubChem CID | 45137554 |
| Molecular Formula | C29H33N3O3 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | [(4R)-3-[4-(4-methoxyphenyl)piperazin-1-yl]piperidin-4-yl] 3-phenylbenzoate |
| SMILES | COc1ccc(N2CCN(C3CNCC[C@H]3OC(=O)c3cccc(-c4ccccc4)c3)CC2)cc1 |
| InChI | InChI=1S/C29H33N3O3/c1-34-26-12-10-25(11-13-26)31-16-18-32(19-17-31)27-21-30-15-14-28(27)35-29(33)24-9-5-8-23(20-24)22-6-3-2-4-7-22/h2-13,20,27-28,30H,14-19,21H2,1H3/t27?,28-/m1/s1 |
| InChIKey | TXTUTQHIJXOUKH-PLYLYKGUSA-N |
| XLogP | 4.07 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|