C20H25N3O — CID 87937359
(3S,4S)-4-[4-(4-phenylphenyl)piperazin-1-yl]pyrrolidin-3-ol (PubChem CID 87937359) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is (3S,4S)-4-[4-(4-phenylphenyl)piperazin-1-yl]pyrrolidin-3-ol.
| Compound Name | (3S,4S)-4-[4-(4-phenylphenyl)piperazin-1-yl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 87937359 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | (3S,4S)-4-[4-(4-phenylphenyl)piperazin-1-yl]pyrrolidin-3-ol |
| SMILES | O[C@H]1CNC[C@@H]1N1CCN(c2ccc(-c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C20H25N3O/c24-20-15-21-14-19(20)23-12-10-22(11-13-23)18-8-6-17(7-9-18)16-4-2-1-3-5-16/h1-9,19-21,24H,10-15H2/t19-,20-/m0/s1 |
| InChIKey | XXLVALQDSWDGOA-PMACEKPBSA-N |
| XLogP | 1.81 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |