C8H16N2O2S — CID 122236780
(3R,4R)-4-(1-oxo-1,4-thiazinan-4-yl)pyrrolidin-3-ol (PubChem CID 122236780) has the molecular formula C8H16N2O2S and a molecular weight of 204.29 g/mol. Its IUPAC name is (3R,4R)-4-(1-oxo-1,4-thiazinan-4-yl)pyrrolidin-3-ol.
| Compound Name | (3R,4R)-4-(1-oxo-1,4-thiazinan-4-yl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 122236780 |
| Molecular Formula | C8H16N2O2S |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | (3R,4R)-4-(1-oxo-1,4-thiazinan-4-yl)pyrrolidin-3-ol |
| SMILES | O=S1CCN([C@@H]2CNC[C@H]2O)CC1 |
| InChI | InChI=1S/C8H16N2O2S/c11-8-6-9-5-7(8)10-1-3-13(12)4-2-10/h7-9,11H,1-6H2/t7-,8-/m1/s1 |
| InChIKey | BSJMGTBYWLQEHC-HTQZYQBOSA-N |
| XLogP | -1.62 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |