C8H17N3O — CID 130905202
(3R,4R)-4-[(3R)-3-aminopyrrolidin-1-yl]pyrrolidin-3-ol (PubChem CID 130905202) has the molecular formula C8H17N3O and a molecular weight of 171.24 g/mol. Its IUPAC name is (3R,4R)-4-[(3R)-3-aminopyrrolidin-1-yl]pyrrolidin-3-ol.
| Compound Name | (3R,4R)-4-[(3R)-3-aminopyrrolidin-1-yl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 130905202 |
| Molecular Formula | C8H17N3O |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | (3R,4R)-4-[(3R)-3-aminopyrrolidin-1-yl]pyrrolidin-3-ol |
| SMILES | N[C@@H]1CCN([C@@H]2CNC[C@H]2O)C1 |
| InChI | InChI=1S/C8H17N3O/c9-6-1-2-11(5-6)7-3-10-4-8(7)12/h6-8,10,12H,1-5,9H2/t6-,7-,8-/m1/s1 |
| InChIKey | RCOFAMXAXJOBCB-BWZBUEFSSA-N |
| XLogP | -1.65 |
| TPSA | 61.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |