About 4-(3,4-dimethoxypyrrolidin-1-yl)pyrrolidin-3-ol
4-(3,4-dimethoxypyrrolidin-1-yl)pyrrolidin-3-ol (PubChem CID 103533926) has the molecular formula C10H20N2O3
and a molecular weight of 216.28 g/mol. Its IUPAC name is 4-(3,4-dimethoxypyrrolidin-1-yl)pyrrolidin-3-ol.
Molecular Properties
| Compound Name | 4-(3,4-dimethoxypyrrolidin-1-yl)pyrrolidin-3-ol |
| PubChem CID | 103533926 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 4-(3,4-dimethoxypyrrolidin-1-yl)pyrrolidin-3-ol |
| SMILES | COC1CN(C2CNCC2O)CC1OC |
| InChI | InChI=1S/C10H20N2O3/c1-14-9-5-12(6-10(9)15-2)7-3-11-4-8(7)13/h7-11,13H,3-6H2,1-2H3 |
| InChIKey | IUCSMYMSBJHDCS-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(3,4-dimethoxypyrrolidin-1-yl)pyrrolidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-dimethoxypyrrolidin-1-yl)pyrrolidin-3-ol?
The IUPAC name of 4-(3,4-dimethoxypyrrolidin-1-yl)pyrrolidin-3-ol (CID 103533926) is 4-(3,4-dimethoxypyrrolidin-1-yl)pyrrolidin-3-ol.
What is the SMILES notation for 4-(3,4-dimethoxypyrrolidin-1-yl)pyrrolidin-3-ol?
The canonical SMILES for 4-(3,4-dimethoxypyrrolidin-1-yl)pyrrolidin-3-ol is COC1CN(C2CNCC2O)CC1OC.
What is the InChIKey of 4-(3,4-dimethoxypyrrolidin-1-yl)pyrrolidin-3-ol?
The InChIKey is IUCSMYMSBJHDCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O3/c1-14-9-5-12(6-10(9)15-2)7-3-11-4-8(7)13/h7-11,13H,3-6H2,1-2H3.
What are the key properties of 4-(3,4-dimethoxypyrrolidin-1-yl)pyrrolidin-3-ol?
4-(3,4-dimethoxypyrrolidin-1-yl)pyrrolidin-3-ol has a molecular weight of 216.28 g/mol, XLogP of -1.34, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dimethoxypyrrolidin-1-yl)pyrrolidin-3-ol is sourced from PubChem (CID 103533926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).