C10H20N2O3 — CID 103533926
4-(3,4-dimethoxypyrrolidin-1-yl)pyrrolidin-3-ol (PubChem CID 103533926) has the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. Its IUPAC name is 4-(3,4-dimethoxypyrrolidin-1-yl)pyrrolidin-3-ol.
| Compound Name | 4-(3,4-dimethoxypyrrolidin-1-yl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 103533926 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 4-(3,4-dimethoxypyrrolidin-1-yl)pyrrolidin-3-ol |
| SMILES | COC1CN(C2CNCC2O)CC1OC |
| InChI | InChI=1S/C10H20N2O3/c1-14-9-5-12(6-10(9)15-2)7-3-11-4-8(7)13/h7-11,13H,3-6H2,1-2H3 |
| InChIKey | IUCSMYMSBJHDCS-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |