C7H15NO4 — CID 18417377
6-methoxyazepane-3,4,5-triol (PubChem CID 18417377) has the molecular formula C7H15NO4 and a molecular weight of 177.20 g/mol. Its IUPAC name is 6-methoxyazepane-3,4,5-triol.
| Compound Name | 6-methoxyazepane-3,4,5-triol |
|---|---|
| PubChem CID | 18417377 |
| Molecular Formula | C7H15NO4 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 6-methoxyazepane-3,4,5-triol |
| SMILES | COC1CNCC(O)C(O)C1O |
| InChI | InChI=1S/C7H15NO4/c1-12-5-3-8-2-4(9)6(10)7(5)11/h4-11H,2-3H2,1H3 |
| InChIKey | GJLZBEMIPRVJIQ-UHFFFAOYSA-N |
| XLogP | -2.31 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | -2.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |