C6H14N2O3 — CID 139845790
(3R,4S,5R,6R)-6-aminoazepane-3,4,5-triol (PubChem CID 139845790) has the molecular formula C6H14N2O3 and a molecular weight of 162.19 g/mol. Its IUPAC name is (3R,4S,5R,6R)-6-aminoazepane-3,4,5-triol.
| Compound Name | (3R,4S,5R,6R)-6-aminoazepane-3,4,5-triol |
|---|---|
| PubChem CID | 139845790 |
| Molecular Formula | C6H14N2O3 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | (3R,4S,5R,6R)-6-aminoazepane-3,4,5-triol |
| SMILES | N[C@@H]1CNC[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H14N2O3/c7-3-1-8-2-4(9)6(11)5(3)10/h3-6,8-11H,1-2,7H2/t3-,4-,5-,6+/m1/s1 |
| InChIKey | GDNRORDMZPCLEU-KAZBKCHUSA-N |
| XLogP | -3.00 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | -3.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |