C6H14N2O2 — CID 101020792
(3S,4R,5S)-3-amino-5-(hydroxymethyl)piperidin-4-ol (PubChem CID 101020792) has the molecular formula C6H14N2O2 and a molecular weight of 146.19 g/mol. Its IUPAC name is (3S,4R,5S)-3-amino-5-(hydroxymethyl)piperidin-4-ol.
| Compound Name | (3S,4R,5S)-3-amino-5-(hydroxymethyl)piperidin-4-ol |
|---|---|
| PubChem CID | 101020792 |
| Molecular Formula | C6H14N2O2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | (3S,4R,5S)-3-amino-5-(hydroxymethyl)piperidin-4-ol |
| SMILES | N[C@H]1CNC[C@@H](CO)[C@H]1O |
| InChI | InChI=1S/C6H14N2O2/c7-5-2-8-1-4(3-9)6(5)10/h4-6,8-10H,1-3,7H2/t4-,5-,6+/m0/s1 |
| InChIKey | MAUMOWWKOAKDDP-HCWXCVPCSA-N |
| XLogP | -2.11 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |