C12H26N2O2 — CID 157146152
[(3S,4S)-4-methylpyrrolidin-3-yl]methanol (PubChem CID 157146152) has the molecular formula C12H26N2O2 and a molecular weight of 230.35 g/mol. Its IUPAC name is [(3S,4S)-4-methylpyrrolidin-3-yl]methanol.
| Compound Name | [(3S,4S)-4-methylpyrrolidin-3-yl]methanol |
|---|---|
| PubChem CID | 157146152 |
| Molecular Formula | C12H26N2O2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | [(3S,4S)-4-methylpyrrolidin-3-yl]methanol |
| SMILES | C[C@@H]1CNC[C@H]1CO.C[C@@H]1CNC[C@H]1CO |
| InChI | InChI=1S/2C6H13NO/c2*1-5-2-7-3-6(5)4-8/h2*5-8H,2-4H2,1H3/t2*5-,6+/m11/s1 |
| InChIKey | AKSKTWKPMVVWCR-NTPRZCPUSA-N |
| XLogP | -0.33 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |