About piperidine-3,4,5-triol;hydrochloride
piperidine-3,4,5-triol;hydrochloride (PubChem CID 73223230) has the molecular formula C5H12ClNO3
and a molecular weight of 169.61 g/mol. Its IUPAC name is piperidine-3,4,5-triol;hydrochloride.
Molecular Properties
| Compound Name | piperidine-3,4,5-triol;hydrochloride |
| PubChem CID | 73223230 |
| Molecular Formula | C5H12ClNO3 |
| Molecular Weight | 169.61 g/mol |
| Exact Mass | 169.05 |
| IUPAC Name | piperidine-3,4,5-triol;hydrochloride |
| SMILES | Cl.OC1CNCC(O)C1O |
| InChI | InChI=1S/C5H11NO3.ClH/c7-3-1-6-2-4(8)5(3)9;/h3-9H,1-2H2;1H |
| InChIKey | SUNAKFXBBOTQAO-UHFFFAOYSA-N |
| XLogP | -1.91 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.61 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze piperidine-3,4,5-triol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidine-3,4,5-triol;hydrochloride?
The IUPAC name of piperidine-3,4,5-triol;hydrochloride (CID 73223230) is piperidine-3,4,5-triol;hydrochloride.
What is the SMILES notation for piperidine-3,4,5-triol;hydrochloride?
The canonical SMILES for piperidine-3,4,5-triol;hydrochloride is Cl.OC1CNCC(O)C1O.
What is the InChIKey of piperidine-3,4,5-triol;hydrochloride?
The InChIKey is SUNAKFXBBOTQAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO3.ClH/c7-3-1-6-2-4(8)5(3)9;/h3-9H,1-2H2;1H.
What are the key properties of piperidine-3,4,5-triol;hydrochloride?
piperidine-3,4,5-triol;hydrochloride has a molecular weight of 169.61 g/mol, XLogP of -1.91, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for piperidine-3,4,5-triol;hydrochloride is sourced from PubChem (CID 73223230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).