C5H12ClNO3 — CID 73223230
piperidine-3,4,5-triol;hydrochloride (PubChem CID 73223230) has the molecular formula C5H12ClNO3 and a molecular weight of 169.61 g/mol. Its IUPAC name is piperidine-3,4,5-triol;hydrochloride.
| Compound Name | piperidine-3,4,5-triol;hydrochloride |
|---|---|
| PubChem CID | 73223230 |
| Molecular Formula | C5H12ClNO3 |
| Molecular Weight | 169.61 g/mol |
| Exact Mass | 169.05 |
| IUPAC Name | piperidine-3,4,5-triol;hydrochloride |
| SMILES | Cl.OC1CNCC(O)C1O |
| InChI | InChI=1S/C5H11NO3.ClH/c7-3-1-6-2-4(8)5(3)9;/h3-9H,1-2H2;1H |
| InChIKey | SUNAKFXBBOTQAO-UHFFFAOYSA-N |
| XLogP | -1.91 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.61 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |