About (3R,4S)-4-(dimethylamino)pyrrolidin-3-ol;dihydrochloride
(3R,4S)-4-(dimethylamino)pyrrolidin-3-ol;dihydrochloride (PubChem CID 112756828) has the molecular formula C6H16Cl2N2O
and a molecular weight of 203.11 g/mol. Its IUPAC name is (3R,4S)-4-(dimethylamino)pyrrolidin-3-ol;dihydrochloride.
Molecular Properties
| Compound Name | (3R,4S)-4-(dimethylamino)pyrrolidin-3-ol;dihydrochloride |
| PubChem CID | 112756828 |
| Molecular Formula | C6H16Cl2N2O |
| Molecular Weight | 203.11 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | (3R,4S)-4-(dimethylamino)pyrrolidin-3-ol;dihydrochloride |
| SMILES | CN(C)[C@H]1CNC[C@H]1O.Cl.Cl |
| InChI | InChI=1S/C6H14N2O.2ClH/c1-8(2)5-3-7-4-6(5)9;;/h5-7,9H,3-4H2,1-2H3;2*1H/t5-,6+;;/m0../s1 |
| InChIKey | DZLFLRAVIZGQMT-KXSOTYCDSA-N |
| XLogP | -0.28 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.11 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R,4S)-4-(dimethylamino)pyrrolidin-3-ol;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4S)-4-(dimethylamino)pyrrolidin-3-ol;dihydrochloride?
The IUPAC name of (3R,4S)-4-(dimethylamino)pyrrolidin-3-ol;dihydrochloride (CID 112756828) is (3R,4S)-4-(dimethylamino)pyrrolidin-3-ol;dihydrochloride.
What is the SMILES notation for (3R,4S)-4-(dimethylamino)pyrrolidin-3-ol;dihydrochloride?
The canonical SMILES for (3R,4S)-4-(dimethylamino)pyrrolidin-3-ol;dihydrochloride is CN(C)[C@H]1CNC[C@H]1O.Cl.Cl.
What is the InChIKey of (3R,4S)-4-(dimethylamino)pyrrolidin-3-ol;dihydrochloride?
The InChIKey is DZLFLRAVIZGQMT-KXSOTYCDSA-N. The full InChI is InChI=1S/C6H14N2O.2ClH/c1-8(2)5-3-7-4-6(5)9;;/h5-7,9H,3-4H2,1-2H3;2*1H/t5-,6+;;/m0../s1.
What are the key properties of (3R,4S)-4-(dimethylamino)pyrrolidin-3-ol;dihydrochloride?
(3R,4S)-4-(dimethylamino)pyrrolidin-3-ol;dihydrochloride has a molecular weight of 203.11 g/mol, XLogP of -0.28, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4S)-4-(dimethylamino)pyrrolidin-3-ol;dihydrochloride is sourced from PubChem (CID 112756828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).