C6H16Cl2N2O — CID 112756828
(3R,4S)-4-(dimethylamino)pyrrolidin-3-ol;dihydrochloride (PubChem CID 112756828) has the molecular formula C6H16Cl2N2O and a molecular weight of 203.11 g/mol. Its IUPAC name is (3R,4S)-4-(dimethylamino)pyrrolidin-3-ol;dihydrochloride.
| Compound Name | (3R,4S)-4-(dimethylamino)pyrrolidin-3-ol;dihydrochloride |
|---|---|
| PubChem CID | 112756828 |
| Molecular Formula | C6H16Cl2N2O |
| Molecular Weight | 203.11 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | (3R,4S)-4-(dimethylamino)pyrrolidin-3-ol;dihydrochloride |
| SMILES | CN(C)[C@H]1CNC[C@H]1O.Cl.Cl |
| InChI | InChI=1S/C6H14N2O.2ClH/c1-8(2)5-3-7-4-6(5)9;;/h5-7,9H,3-4H2,1-2H3;2*1H/t5-,6+;;/m0../s1 |
| InChIKey | DZLFLRAVIZGQMT-KXSOTYCDSA-N |
| XLogP | -0.28 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.11 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |