C8H17N3O2 — CID 131067305
2-[[(3R,4R)-4-hydroxypyrrolidin-3-yl]-methylamino]propanamide (PubChem CID 131067305) has the molecular formula C8H17N3O2 and a molecular weight of 187.24 g/mol. Its IUPAC name is 2-[[(3R,4R)-4-hydroxypyrrolidin-3-yl]-methylamino]propanamide.
| Compound Name | 2-[[(3R,4R)-4-hydroxypyrrolidin-3-yl]-methylamino]propanamide |
|---|---|
| PubChem CID | 131067305 |
| Molecular Formula | C8H17N3O2 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.13 |
| IUPAC Name | 2-[[(3R,4R)-4-hydroxypyrrolidin-3-yl]-methylamino]propanamide |
| SMILES | CC(C(N)=O)N(C)[C@@H]1CNC[C@H]1O |
| InChI | InChI=1S/C8H17N3O2/c1-5(8(9)13)11(2)6-3-10-4-7(6)12/h5-7,10,12H,3-4H2,1-2H3,(H2,9,13)/t5?,6-,7-/m1/s1 |
| InChIKey | HPNJOHQUXHBMSB-JXBXZBNISA-N |
| XLogP | -1.88 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |