C7H16N2O2 — CID 156809597
(3S,4R,5S)-5-(dimethylamino)piperidine-3,4-diol (PubChem CID 156809597) has the molecular formula C7H16N2O2 and a molecular weight of 160.22 g/mol. Its IUPAC name is (3S,4R,5S)-5-(dimethylamino)piperidine-3,4-diol.
| Compound Name | (3S,4R,5S)-5-(dimethylamino)piperidine-3,4-diol |
|---|---|
| PubChem CID | 156809597 |
| Molecular Formula | C7H16N2O2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.12 |
| IUPAC Name | (3S,4R,5S)-5-(dimethylamino)piperidine-3,4-diol |
| SMILES | CN(C)[C@H]1CNC[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C7H16N2O2/c1-9(2)5-3-8-4-6(10)7(5)11/h5-8,10-11H,3-4H2,1-2H3/t5-,6-,7+/m0/s1 |
| InChIKey | CQYKPYNQVWKOFT-LYFYHCNISA-N |
| XLogP | -1.76 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |