C7H16N2 — CID 142439406
(4S)-N,N,4-trimethylpyrrolidin-3-amine (PubChem CID 142439406) has the molecular formula C7H16N2 and a molecular weight of 128.22 g/mol. Its IUPAC name is (4S)-N,N,4-trimethylpyrrolidin-3-amine.
| Compound Name | (4S)-N,N,4-trimethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 142439406 |
| Molecular Formula | C7H16N2 |
| Molecular Weight | 128.22 g/mol |
| Exact Mass | 128.13 |
| IUPAC Name | (4S)-N,N,4-trimethylpyrrolidin-3-amine |
| SMILES | C[C@H]1CNCC1N(C)C |
| InChI | InChI=1S/C7H16N2/c1-6-4-8-5-7(6)9(2)3/h6-8H,4-5H2,1-3H3/t6-,7?/m0/s1 |
| InChIKey | WPWPUGYLNCMHFP-PKPIPKONSA-N |
| XLogP | 0.16 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.22 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |