C10H22N2 — CID 165468899
N-ethyl-N,3,5-trimethylpiperidin-4-amine (PubChem CID 165468899) has the molecular formula C10H22N2 and a molecular weight of 170.30 g/mol. Its IUPAC name is N-ethyl-N,3,5-trimethylpiperidin-4-amine.
| Compound Name | N-ethyl-N,3,5-trimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 165468899 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | N-ethyl-N,3,5-trimethylpiperidin-4-amine |
| SMILES | CCN(C)C1C(C)CNCC1C |
| InChI | InChI=1S/C10H22N2/c1-5-12(4)10-8(2)6-11-7-9(10)3/h8-11H,5-7H2,1-4H3 |
| InChIKey | XMXLXPHCARUFJP-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |