C7H17ClN2O — CID 156592163
(3S,4S)-4-(dimethylamino)piperidin-3-ol;hydrochloride (PubChem CID 156592163) has the molecular formula C7H17ClN2O and a molecular weight of 180.68 g/mol. Its IUPAC name is (3S,4S)-4-(dimethylamino)piperidin-3-ol;hydrochloride.
| Compound Name | (3S,4S)-4-(dimethylamino)piperidin-3-ol;hydrochloride |
|---|---|
| PubChem CID | 156592163 |
| Molecular Formula | C7H17ClN2O |
| Molecular Weight | 180.68 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | (3S,4S)-4-(dimethylamino)piperidin-3-ol;hydrochloride |
| SMILES | CN(C)[C@H]1CCNC[C@@H]1O.Cl |
| InChI | InChI=1S/C7H16N2O.ClH/c1-9(2)6-3-4-8-5-7(6)10;/h6-8,10H,3-5H2,1-2H3;1H/t6-,7-;/m0./s1 |
| InChIKey | RNPCSBPVXOFDRL-LEUCUCNGSA-N |
| XLogP | -0.31 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.68 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |