C5H14Cl2N2O — CID 171370179
(3S,4S)-3-aminopiperidin-4-ol;dihydrochloride (PubChem CID 171370179) has the molecular formula C5H14Cl2N2O and a molecular weight of 189.09 g/mol. Its IUPAC name is (3S,4S)-3-aminopiperidin-4-ol;dihydrochloride.
| Compound Name | (3S,4S)-3-aminopiperidin-4-ol;dihydrochloride |
|---|---|
| PubChem CID | 171370179 |
| Molecular Formula | C5H14Cl2N2O |
| Molecular Weight | 189.09 g/mol |
| Exact Mass | 188.05 |
| IUPAC Name | (3S,4S)-3-aminopiperidin-4-ol;dihydrochloride |
| SMILES | Cl.Cl.N[C@H]1CNCC[C@@H]1O |
| InChI | InChI=1S/C5H12N2O.2ClH/c6-4-3-7-2-1-5(4)8;;/h4-5,7-8H,1-3,6H2;2*1H/t4-,5-;;/m0../s1 |
| InChIKey | SJLRDSYIJUETQL-RSLHMRQOSA-N |
| XLogP | -0.49 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.09 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |