About 3-aminopiperidin-4-ol;benzyl carbonochloridate
3-aminopiperidin-4-ol;benzyl carbonochloridate (PubChem CID 175289622) has the molecular formula C13H19ClN2O3
and a molecular weight of 286.76 g/mol. Its IUPAC name is 3-aminopiperidin-4-ol;benzyl carbonochloridate.
Molecular Properties
| Compound Name | 3-aminopiperidin-4-ol;benzyl carbonochloridate |
| PubChem CID | 175289622 |
| Molecular Formula | C13H19ClN2O3 |
| Molecular Weight | 286.76 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 3-aminopiperidin-4-ol;benzyl carbonochloridate |
| SMILES | NC1CNCCC1O.O=C(Cl)OCc1ccccc1 |
| InChI | InChI=1S/C8H7ClO2.C5H12N2O/c9-8(10)11-6-7-4-2-1-3-5-7;6-4-3-7-2-1-5(4)8/h1-5H,6H2;4-5,7-8H,1-3,6H2 |
| InChIKey | VLQAMFTZKDTEPV-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.76 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-aminopiperidin-4-ol;benzyl carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminopiperidin-4-ol;benzyl carbonochloridate?
The IUPAC name of 3-aminopiperidin-4-ol;benzyl carbonochloridate (CID 175289622) is 3-aminopiperidin-4-ol;benzyl carbonochloridate.
What is the SMILES notation for 3-aminopiperidin-4-ol;benzyl carbonochloridate?
The canonical SMILES for 3-aminopiperidin-4-ol;benzyl carbonochloridate is NC1CNCCC1O.O=C(Cl)OCc1ccccc1.
What is the InChIKey of 3-aminopiperidin-4-ol;benzyl carbonochloridate?
The InChIKey is VLQAMFTZKDTEPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClO2.C5H12N2O/c9-8(10)11-6-7-4-2-1-3-5-7;6-4-3-7-2-1-5(4)8/h1-5H,6H2;4-5,7-8H,1-3,6H2.
What are the key properties of 3-aminopiperidin-4-ol;benzyl carbonochloridate?
3-aminopiperidin-4-ol;benzyl carbonochloridate has a molecular weight of 286.76 g/mol, XLogP of 1.23, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminopiperidin-4-ol;benzyl carbonochloridate is sourced from PubChem (CID 175289622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).