About azetidine-3-carbonyl chloride;benzyl carbonochloridate
azetidine-3-carbonyl chloride;benzyl carbonochloridate (PubChem CID 175294608) has the molecular formula C12H13Cl2NO3
and a molecular weight of 290.15 g/mol. Its IUPAC name is azetidine-3-carbonyl chloride;benzyl carbonochloridate.
Molecular Properties
| Compound Name | azetidine-3-carbonyl chloride;benzyl carbonochloridate |
| PubChem CID | 175294608 |
| Molecular Formula | C12H13Cl2NO3 |
| Molecular Weight | 290.15 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | azetidine-3-carbonyl chloride;benzyl carbonochloridate |
| SMILES | O=C(Cl)C1CNC1.O=C(Cl)OCc1ccccc1 |
| InChI | InChI=1S/C8H7ClO2.C4H6ClNO/c9-8(10)11-6-7-4-2-1-3-5-7;5-4(7)3-1-6-2-3/h1-5H,6H2;3,6H,1-2H2 |
| InChIKey | QBLRYVTTWIBNCS-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.15 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze azetidine-3-carbonyl chloride;benzyl carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azetidine-3-carbonyl chloride;benzyl carbonochloridate?
The IUPAC name of azetidine-3-carbonyl chloride;benzyl carbonochloridate (CID 175294608) is azetidine-3-carbonyl chloride;benzyl carbonochloridate.
What is the SMILES notation for azetidine-3-carbonyl chloride;benzyl carbonochloridate?
The canonical SMILES for azetidine-3-carbonyl chloride;benzyl carbonochloridate is O=C(Cl)C1CNC1.O=C(Cl)OCc1ccccc1.
What is the InChIKey of azetidine-3-carbonyl chloride;benzyl carbonochloridate?
The InChIKey is QBLRYVTTWIBNCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClO2.C4H6ClNO/c9-8(10)11-6-7-4-2-1-3-5-7;5-4(7)3-1-6-2-3/h1-5H,6H2;3,6H,1-2H2.
What are the key properties of azetidine-3-carbonyl chloride;benzyl carbonochloridate?
azetidine-3-carbonyl chloride;benzyl carbonochloridate has a molecular weight of 290.15 g/mol, XLogP of 2.53, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azetidine-3-carbonyl chloride;benzyl carbonochloridate is sourced from PubChem (CID 175294608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).