About benzyl carbonochloridate;(3S)-3-fluoro-3-methylpyrrolidine
benzyl carbonochloridate;(3S)-3-fluoro-3-methylpyrrolidine (PubChem CID 158673832) has the molecular formula C13H17ClFNO2
and a molecular weight of 273.74 g/mol. Its IUPAC name is benzyl carbonochloridate;(3S)-3-fluoro-3-methylpyrrolidine.
Molecular Properties
| Compound Name | benzyl carbonochloridate;(3S)-3-fluoro-3-methylpyrrolidine |
| PubChem CID | 158673832 |
| Molecular Formula | C13H17ClFNO2 |
| Molecular Weight | 273.74 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | benzyl carbonochloridate;(3S)-3-fluoro-3-methylpyrrolidine |
| SMILES | C[C@]1(F)CCNC1.O=C(Cl)OCc1ccccc1 |
| InChI | InChI=1S/C8H7ClO2.C5H10FN/c9-8(10)11-6-7-4-2-1-3-5-7;1-5(6)2-3-7-4-5/h1-5H,6H2;7H,2-4H2,1H3/t;5-/m.0/s1 |
| InChIKey | IEGPCGVQIZAJGE-ZSCHJXSPSA-N |
| XLogP | 3.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.74 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze benzyl carbonochloridate;(3S)-3-fluoro-3-methylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl carbonochloridate;(3S)-3-fluoro-3-methylpyrrolidine?
The IUPAC name of benzyl carbonochloridate;(3S)-3-fluoro-3-methylpyrrolidine (CID 158673832) is benzyl carbonochloridate;(3S)-3-fluoro-3-methylpyrrolidine.
What is the SMILES notation for benzyl carbonochloridate;(3S)-3-fluoro-3-methylpyrrolidine?
The canonical SMILES for benzyl carbonochloridate;(3S)-3-fluoro-3-methylpyrrolidine is C[C@]1(F)CCNC1.O=C(Cl)OCc1ccccc1.
What is the InChIKey of benzyl carbonochloridate;(3S)-3-fluoro-3-methylpyrrolidine?
The InChIKey is IEGPCGVQIZAJGE-ZSCHJXSPSA-N. The full InChI is InChI=1S/C8H7ClO2.C5H10FN/c9-8(10)11-6-7-4-2-1-3-5-7;1-5(6)2-3-7-4-5/h1-5H,6H2;7H,2-4H2,1H3/t;5-/m.0/s1.
What are the key properties of benzyl carbonochloridate;(3S)-3-fluoro-3-methylpyrrolidine?
benzyl carbonochloridate;(3S)-3-fluoro-3-methylpyrrolidine has a molecular weight of 273.74 g/mol, XLogP of 3.27, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl carbonochloridate;(3S)-3-fluoro-3-methylpyrrolidine is sourced from PubChem (CID 158673832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).