C15H18F2N2O2 — CID 135393291
benzyl 5,5-difluoro-2,7-diazaspiro[3.5]nonane-2-carboxylate (PubChem CID 135393291) has the molecular formula C15H18F2N2O2 and a molecular weight of 296.32 g/mol. Its IUPAC name is benzyl 5,5-difluoro-2,7-diazaspiro[3.5]nonane-2-carboxylate.
| Compound Name | benzyl 5,5-difluoro-2,7-diazaspiro[3.5]nonane-2-carboxylate |
|---|---|
| PubChem CID | 135393291 |
| Molecular Formula | C15H18F2N2O2 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | benzyl 5,5-difluoro-2,7-diazaspiro[3.5]nonane-2-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CC2(CCNCC2(F)F)C1 |
| InChI | InChI=1S/C15H18F2N2O2/c16-15(17)9-18-7-6-14(15)10-19(11-14)13(20)21-8-12-4-2-1-3-5-12/h1-5,18H,6-11H2 |
| InChIKey | WEJZMGBFEHQMIZ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |