C16H18F2N2O3 — CID 155892862
benzyl 6,6-difluoro-3-oxo-2,8-diazaspiro[4.5]decane-8-carboxylate (PubChem CID 155892862) has the molecular formula C16H18F2N2O3 and a molecular weight of 324.33 g/mol. Its IUPAC name is benzyl 6,6-difluoro-3-oxo-2,8-diazaspiro[4.5]decane-8-carboxylate.
| Compound Name | benzyl 6,6-difluoro-3-oxo-2,8-diazaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 155892862 |
| Molecular Formula | C16H18F2N2O3 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | benzyl 6,6-difluoro-3-oxo-2,8-diazaspiro[4.5]decane-8-carboxylate |
| SMILES | O=C1CC2(CCN(C(=O)OCc3ccccc3)CC2(F)F)CN1 |
| InChI | InChI=1S/C16H18F2N2O3/c17-16(18)11-20(7-6-15(16)8-13(21)19-10-15)14(22)23-9-12-4-2-1-3-5-12/h1-5H,6-11H2,(H,19,21) |
| InChIKey | YAMDQTHQPIXWNP-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |