C16H20F2N2O2S — CID 137432971
benzyl 5,5-difluoro-2-methylsulfanyl-2,7-diazaspiro[3.5]nonane-7-carboxylate (PubChem CID 137432971) has the molecular formula C16H20F2N2O2S and a molecular weight of 342.41 g/mol. Its IUPAC name is benzyl 5,5-difluoro-2-methylsulfanyl-2,7-diazaspiro[3.5]nonane-7-carboxylate.
| Compound Name | benzyl 5,5-difluoro-2-methylsulfanyl-2,7-diazaspiro[3.5]nonane-7-carboxylate |
|---|---|
| PubChem CID | 137432971 |
| Molecular Formula | C16H20F2N2O2S |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | benzyl 5,5-difluoro-2-methylsulfanyl-2,7-diazaspiro[3.5]nonane-7-carboxylate |
| SMILES | CSN1CC2(CCN(C(=O)OCc3ccccc3)CC2(F)F)C1 |
| InChI | InChI=1S/C16H20F2N2O2S/c1-23-20-10-15(11-20)7-8-19(12-16(15,17)18)14(21)22-9-13-5-3-2-4-6-13/h2-6H,7-12H2,1H3 |
| InChIKey | AFLWZFXSZXCCLG-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|