About benzyl (4S)-1-oxa-7-azaspiro[3.4]octane-7-carboxylate;methanol;(4S)-1-oxa-7-azaspiro[3.4]octane
benzyl (4S)-1-oxa-7-azaspiro[3.4]octane-7-carboxylate;methanol;(4S)-1-oxa-7-azaspiro[3.4]octane (PubChem CID 157316981) has the molecular formula C21H32N2O5
and a molecular weight of 392.50 g/mol. Its IUPAC name is benzyl (4S)-1-oxa-7-azaspiro[3.4]octane-7-carboxylate;methanol;(4S)-1-oxa-7-azaspiro[3.4]octane.
Molecular Properties
| Compound Name | benzyl (4S)-1-oxa-7-azaspiro[3.4]octane-7-carboxylate;methanol;(4S)-1-oxa-7-azaspiro[3.4]octane |
| PubChem CID | 157316981 |
| Molecular Formula | C21H32N2O5 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | benzyl (4S)-1-oxa-7-azaspiro[3.4]octane-7-carboxylate;methanol;(4S)-1-oxa-7-azaspiro[3.4]octane |
| SMILES | C1C[C@]2(CCO2)CN1.CO.O=C(OCc1ccccc1)N1CC[C@]2(CCO2)C1 |
| InChI | InChI=1S/C14H17NO3.C6H11NO.CH4O/c16-13(17-10-12-4-2-1-3-5-12)15-8-6-14(11-15)7-9-18-14;1-3-7-5-6(1)2-4-8-6;1-2/h1-5H,6-11H2;7H,1-5H2;2H,1H3/t14-;6-;/m00./s1 |
| InChIKey | BDSDRZTVYIKTJX-QBNOCWEYSA-N |
| XLogP | 1.94 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze benzyl (4S)-1-oxa-7-azaspiro[3.4]octane-7-carboxylate;methanol;(4S)-1-oxa-7-azaspiro[3.4]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl (4S)-1-oxa-7-azaspiro[3.4]octane-7-carboxylate;methanol;(4S)-1-oxa-7-azaspiro[3.4]octane?
The IUPAC name of benzyl (4S)-1-oxa-7-azaspiro[3.4]octane-7-carboxylate;methanol;(4S)-1-oxa-7-azaspiro[3.4]octane (CID 157316981) is benzyl (4S)-1-oxa-7-azaspiro[3.4]octane-7-carboxylate;methanol;(4S)-1-oxa-7-azaspiro[3.4]octane.
What is the SMILES notation for benzyl (4S)-1-oxa-7-azaspiro[3.4]octane-7-carboxylate;methanol;(4S)-1-oxa-7-azaspiro[3.4]octane?
The canonical SMILES for benzyl (4S)-1-oxa-7-azaspiro[3.4]octane-7-carboxylate;methanol;(4S)-1-oxa-7-azaspiro[3.4]octane is C1C[C@]2(CCO2)CN1.CO.O=C(OCc1ccccc1)N1CC[C@]2(CCO2)C1.
What is the InChIKey of benzyl (4S)-1-oxa-7-azaspiro[3.4]octane-7-carboxylate;methanol;(4S)-1-oxa-7-azaspiro[3.4]octane?
The InChIKey is BDSDRZTVYIKTJX-QBNOCWEYSA-N. The full InChI is InChI=1S/C14H17NO3.C6H11NO.CH4O/c16-13(17-10-12-4-2-1-3-5-12)15-8-6-14(11-15)7-9-18-14;1-3-7-5-6(1)2-4-8-6;1-2/h1-5H,6-11H2;7H,1-5H2;2H,1H3/t14-;6-;/m00./s1.
What are the key properties of benzyl (4S)-1-oxa-7-azaspiro[3.4]octane-7-carboxylate;methanol;(4S)-1-oxa-7-azaspiro[3.4]octane?
benzyl (4S)-1-oxa-7-azaspiro[3.4]octane-7-carboxylate;methanol;(4S)-1-oxa-7-azaspiro[3.4]octane has a molecular weight of 392.50 g/mol, XLogP of 1.94, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl (4S)-1-oxa-7-azaspiro[3.4]octane-7-carboxylate;methanol;(4S)-1-oxa-7-azaspiro[3.4]octane is sourced from PubChem (CID 157316981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).