C10H19NO5S — CID 103536907
4-(3,4-dimethoxypyrrolidin-1-yl)-1,1-dioxothiolan-3-ol (PubChem CID 103536907) has the molecular formula C10H19NO5S and a molecular weight of 265.33 g/mol. Its IUPAC name is 4-(3,4-dimethoxypyrrolidin-1-yl)-1,1-dioxothiolan-3-ol.
| Compound Name | 4-(3,4-dimethoxypyrrolidin-1-yl)-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 103536907 |
| Molecular Formula | C10H19NO5S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 4-(3,4-dimethoxypyrrolidin-1-yl)-1,1-dioxothiolan-3-ol |
| SMILES | COC1CN(C2CS(=O)(=O)CC2O)CC1OC |
| InChI | InChI=1S/C10H19NO5S/c1-15-9-3-11(4-10(9)16-2)7-5-17(13,14)6-8(7)12/h7-10,12H,3-6H2,1-2H3 |
| InChIKey | MAQLLSVRXJHSSM-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |