About 4-(3,4-dimethoxypyrrolidin-1-yl)-1,1-dioxothiolan-3-ol
4-(3,4-dimethoxypyrrolidin-1-yl)-1,1-dioxothiolan-3-ol (PubChem CID 103536907) has the molecular formula C10H19NO5S
and a molecular weight of 265.33 g/mol. Its IUPAC name is 4-(3,4-dimethoxypyrrolidin-1-yl)-1,1-dioxothiolan-3-ol.
Molecular Properties
| Compound Name | 4-(3,4-dimethoxypyrrolidin-1-yl)-1,1-dioxothiolan-3-ol |
| PubChem CID | 103536907 |
| Molecular Formula | C10H19NO5S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 4-(3,4-dimethoxypyrrolidin-1-yl)-1,1-dioxothiolan-3-ol |
| SMILES | COC1CN(C2CS(=O)(=O)CC2O)CC1OC |
| InChI | InChI=1S/C10H19NO5S/c1-15-9-3-11(4-10(9)16-2)7-5-17(13,14)6-8(7)12/h7-10,12H,3-6H2,1-2H3 |
| InChIKey | MAQLLSVRXJHSSM-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(3,4-dimethoxypyrrolidin-1-yl)-1,1-dioxothiolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-dimethoxypyrrolidin-1-yl)-1,1-dioxothiolan-3-ol?
The IUPAC name of 4-(3,4-dimethoxypyrrolidin-1-yl)-1,1-dioxothiolan-3-ol (CID 103536907) is 4-(3,4-dimethoxypyrrolidin-1-yl)-1,1-dioxothiolan-3-ol.
What is the SMILES notation for 4-(3,4-dimethoxypyrrolidin-1-yl)-1,1-dioxothiolan-3-ol?
The canonical SMILES for 4-(3,4-dimethoxypyrrolidin-1-yl)-1,1-dioxothiolan-3-ol is COC1CN(C2CS(=O)(=O)CC2O)CC1OC.
What is the InChIKey of 4-(3,4-dimethoxypyrrolidin-1-yl)-1,1-dioxothiolan-3-ol?
The InChIKey is MAQLLSVRXJHSSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO5S/c1-15-9-3-11(4-10(9)16-2)7-5-17(13,14)6-8(7)12/h7-10,12H,3-6H2,1-2H3.
What are the key properties of 4-(3,4-dimethoxypyrrolidin-1-yl)-1,1-dioxothiolan-3-ol?
4-(3,4-dimethoxypyrrolidin-1-yl)-1,1-dioxothiolan-3-ol has a molecular weight of 265.33 g/mol, XLogP of -1.51, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dimethoxypyrrolidin-1-yl)-1,1-dioxothiolan-3-ol is sourced from PubChem (CID 103536907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).