C9H16N2O4S — CID 99976976
4-[(3R,4R)-4-hydroxy-1,1-dioxothiolan-3-yl]piperazine-1-carbaldehyde (PubChem CID 99976976) has the molecular formula C9H16N2O4S and a molecular weight of 248.30 g/mol. Its IUPAC name is 4-[(3R,4R)-4-hydroxy-1,1-dioxothiolan-3-yl]piperazine-1-carbaldehyde.
| Compound Name | 4-[(3R,4R)-4-hydroxy-1,1-dioxothiolan-3-yl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 99976976 |
| Molecular Formula | C9H16N2O4S |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 4-[(3R,4R)-4-hydroxy-1,1-dioxothiolan-3-yl]piperazine-1-carbaldehyde |
| SMILES | O=CN1CCN([C@H]2CS(=O)(=O)C[C@@H]2O)CC1 |
| InChI | InChI=1S/C9H16N2O4S/c12-7-10-1-3-11(4-2-10)8-5-16(14,15)6-9(8)13/h7-9,13H,1-6H2/t8-,9-/m0/s1 |
| InChIKey | OXDOBQYJSWKKRS-IUCAKERBSA-N |
| XLogP | -2.08 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|