About (3S,4S)-4-[4-(2-fluoroethyl)piperazin-1-yl]-1,1-dioxothiolan-3-ol
(3S,4S)-4-[4-(2-fluoroethyl)piperazin-1-yl]-1,1-dioxothiolan-3-ol (PubChem CID 126846803) has the molecular formula C10H19FN2O3S
and a molecular weight of 266.34 g/mol. Its IUPAC name is (3S,4S)-4-[4-(2-fluoroethyl)piperazin-1-yl]-1,1-dioxothiolan-3-ol.
Molecular Properties
| Compound Name | (3S,4S)-4-[4-(2-fluoroethyl)piperazin-1-yl]-1,1-dioxothiolan-3-ol |
| PubChem CID | 126846803 |
| Molecular Formula | C10H19FN2O3S |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | (3S,4S)-4-[4-(2-fluoroethyl)piperazin-1-yl]-1,1-dioxothiolan-3-ol |
| SMILES | O=S1(=O)C[C@@H](O)[C@H](N2CCN(CCF)CC2)C1 |
| InChI | InChI=1S/C10H19FN2O3S/c11-1-2-12-3-5-13(6-4-12)9-7-17(15,16)8-10(9)14/h9-10,14H,1-8H2/t9-,10-/m1/s1 |
| InChIKey | VIXHQUWBHDJCDN-NXEZZACHSA-N |
| XLogP | -1.27 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3S,4S)-4-[4-(2-fluoroethyl)piperazin-1-yl]-1,1-dioxothiolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-4-[4-(2-fluoroethyl)piperazin-1-yl]-1,1-dioxothiolan-3-ol?
The IUPAC name of (3S,4S)-4-[4-(2-fluoroethyl)piperazin-1-yl]-1,1-dioxothiolan-3-ol (CID 126846803) is (3S,4S)-4-[4-(2-fluoroethyl)piperazin-1-yl]-1,1-dioxothiolan-3-ol.
What is the SMILES notation for (3S,4S)-4-[4-(2-fluoroethyl)piperazin-1-yl]-1,1-dioxothiolan-3-ol?
The canonical SMILES for (3S,4S)-4-[4-(2-fluoroethyl)piperazin-1-yl]-1,1-dioxothiolan-3-ol is O=S1(=O)C[C@@H](O)[C@H](N2CCN(CCF)CC2)C1.
What is the InChIKey of (3S,4S)-4-[4-(2-fluoroethyl)piperazin-1-yl]-1,1-dioxothiolan-3-ol?
The InChIKey is VIXHQUWBHDJCDN-NXEZZACHSA-N. The full InChI is InChI=1S/C10H19FN2O3S/c11-1-2-12-3-5-13(6-4-12)9-7-17(15,16)8-10(9)14/h9-10,14H,1-8H2/t9-,10-/m1/s1.
What are the key properties of (3S,4S)-4-[4-(2-fluoroethyl)piperazin-1-yl]-1,1-dioxothiolan-3-ol?
(3S,4S)-4-[4-(2-fluoroethyl)piperazin-1-yl]-1,1-dioxothiolan-3-ol has a molecular weight of 266.34 g/mol, XLogP of -1.27, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-4-[4-(2-fluoroethyl)piperazin-1-yl]-1,1-dioxothiolan-3-ol is sourced from PubChem (CID 126846803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).