C10H19FN2O3S — CID 126846803
(3S,4S)-4-[4-(2-fluoroethyl)piperazin-1-yl]-1,1-dioxothiolan-3-ol (PubChem CID 126846803) has the molecular formula C10H19FN2O3S and a molecular weight of 266.34 g/mol. Its IUPAC name is (3S,4S)-4-[4-(2-fluoroethyl)piperazin-1-yl]-1,1-dioxothiolan-3-ol.
| Compound Name | (3S,4S)-4-[4-(2-fluoroethyl)piperazin-1-yl]-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 126846803 |
| Molecular Formula | C10H19FN2O3S |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | (3S,4S)-4-[4-(2-fluoroethyl)piperazin-1-yl]-1,1-dioxothiolan-3-ol |
| SMILES | O=S1(=O)C[C@@H](O)[C@H](N2CCN(CCF)CC2)C1 |
| InChI | InChI=1S/C10H19FN2O3S/c11-1-2-12-3-5-13(6-4-12)9-7-17(15,16)8-10(9)14/h9-10,14H,1-8H2/t9-,10-/m1/s1 |
| InChIKey | VIXHQUWBHDJCDN-NXEZZACHSA-N |
| XLogP | -1.27 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |