C10H20N2O4S — CID 21498578
2-[4-(2-hydroxyethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]ethanol (PubChem CID 21498578) has the molecular formula C10H20N2O4S and a molecular weight of 264.35 g/mol. Its IUPAC name is 2-[4-(2-hydroxyethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]ethanol.
| Compound Name | 2-[4-(2-hydroxyethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]ethanol |
|---|---|
| PubChem CID | 21498578 |
| Molecular Formula | C10H20N2O4S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 2-[4-(2-hydroxyethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]ethanol |
| SMILES | O=S1(=O)CC2C(C1)N(CCO)CCN2CCO |
| InChI | InChI=1S/C10H20N2O4S/c13-5-3-11-1-2-12(4-6-14)10-8-17(15,16)7-9(10)11/h9-10,13-14H,1-8H2 |
| InChIKey | HHYAGYZFQLKTPK-UHFFFAOYSA-N |
| XLogP | -2.25 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |