C13H24N2O3S — CID 60968587
4-(4-cyclopentylpiperazin-1-yl)-1,1-dioxothiolan-3-ol (PubChem CID 60968587) has the molecular formula C13H24N2O3S and a molecular weight of 288.41 g/mol. Its IUPAC name is 4-(4-cyclopentylpiperazin-1-yl)-1,1-dioxothiolan-3-ol.
| Compound Name | 4-(4-cyclopentylpiperazin-1-yl)-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 60968587 |
| Molecular Formula | C13H24N2O3S |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 4-(4-cyclopentylpiperazin-1-yl)-1,1-dioxothiolan-3-ol |
| SMILES | O=S1(=O)CC(O)C(N2CCN(C3CCCC3)CC2)C1 |
| InChI | InChI=1S/C13H24N2O3S/c16-13-10-19(17,18)9-12(13)15-7-5-14(6-8-15)11-3-1-2-4-11/h11-13,16H,1-10H2 |
| InChIKey | VFWNXXQWEVGPDK-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |