C10H19ClNO3S- — CID 21179780
4-(2-methylpiperidin-1-yl)-1,1-dioxothiolan-3-ol chloride (PubChem CID 21179780) has the molecular formula C10H19ClNO3S- and a molecular weight of 268.79 g/mol. Its IUPAC name is 4-(2-methylpiperidin-1-yl)-1,1-dioxothiolan-3-ol chloride.
| Compound Name | 4-(2-methylpiperidin-1-yl)-1,1-dioxothiolan-3-ol chloride |
|---|---|
| PubChem CID | 21179780 |
| Molecular Formula | C10H19ClNO3S- |
| Molecular Weight | 268.79 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 4-(2-methylpiperidin-1-yl)-1,1-dioxothiolan-3-ol chloride |
| SMILES | CC1CCCCN1C1CS(=O)(=O)CC1O.[Cl-] |
| InChI | InChI=1S/C10H19NO3S.ClH/c1-8-4-2-3-5-11(8)9-6-15(13,14)7-10(9)12;/h8-10,12H,2-7H2,1H3;1H/p-1 |
| InChIKey | VTFYISIUZRGNMM-UHFFFAOYSA-M |
| XLogP | -2.98 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.79 |
| LogP ≤ 5 | -2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |