C13H26N2O4S — CID 63855136
4-[2-[(2-methoxyethylamino)methyl]piperidin-1-yl]-1,1-dioxothiolan-3-ol (PubChem CID 63855136) has the molecular formula C13H26N2O4S and a molecular weight of 306.43 g/mol. Its IUPAC name is 4-[2-[(2-methoxyethylamino)methyl]piperidin-1-yl]-1,1-dioxothiolan-3-ol.
| Compound Name | 4-[2-[(2-methoxyethylamino)methyl]piperidin-1-yl]-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 63855136 |
| Molecular Formula | C13H26N2O4S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 4-[2-[(2-methoxyethylamino)methyl]piperidin-1-yl]-1,1-dioxothiolan-3-ol |
| SMILES | COCCNCC1CCCCN1C1CS(=O)(=O)CC1O |
| InChI | InChI=1S/C13H26N2O4S/c1-19-7-5-14-8-11-4-2-3-6-15(11)12-9-20(17,18)10-13(12)16/h11-14,16H,2-10H2,1H3 |
| InChIKey | ADSWTQYBMJRCTC-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|