C12H23NO4S — CID 114337919
4-[2-(2-hydroxypropyl)piperidin-1-yl]-1,1-dioxothiolan-3-ol (PubChem CID 114337919) has the molecular formula C12H23NO4S and a molecular weight of 277.39 g/mol. Its IUPAC name is 4-[2-(2-hydroxypropyl)piperidin-1-yl]-1,1-dioxothiolan-3-ol.
| Compound Name | 4-[2-(2-hydroxypropyl)piperidin-1-yl]-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 114337919 |
| Molecular Formula | C12H23NO4S |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 4-[2-(2-hydroxypropyl)piperidin-1-yl]-1,1-dioxothiolan-3-ol |
| SMILES | CC(O)CC1CCCCN1C1CS(=O)(=O)CC1O |
| InChI | InChI=1S/C12H23NO4S/c1-9(14)6-10-4-2-3-5-13(10)11-7-18(16,17)8-12(11)15/h9-12,14-15H,2-8H2,1H3 |
| InChIKey | CPDISQHIIFQEOX-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |