C11H21NO — CID 102734292
trans-(1S,2S)-2-(2-methylpiperidin-1-yl)cyclopentan-1-ol (PubChem CID 102734292) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is trans-(1S,2S)-2-(2-methylpiperidin-1-yl)cyclopentan-1-ol.
| Compound Name | trans-(1S,2S)-2-(2-methylpiperidin-1-yl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 102734292 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | trans-(1S,2S)-2-(2-methylpiperidin-1-yl)cyclopentan-1-ol |
| SMILES | CC1CCCCN1[C@H]1CCC[C@@H]1O |
| InChI | InChI=1S/C11H21NO/c1-9-5-2-3-8-12(9)10-6-4-7-11(10)13/h9-11,13H,2-8H2,1H3/t9?,10-,11-/m0/s1 |
| InChIKey | JFNSDEHZCFKJBQ-DVRYWGNFSA-N |
| XLogP | 1.77 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |