C14H26N2O — CID 102734859
trans-(1R,2R)-2-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)cyclopentan-1-ol (PubChem CID 102734859) has the molecular formula C14H26N2O and a molecular weight of 238.37 g/mol. Its IUPAC name is trans-(1R,2R)-2-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)cyclopentan-1-ol.
| Compound Name | trans-(1R,2R)-2-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 102734859 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | trans-(1R,2R)-2-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)cyclopentan-1-ol |
| SMILES | CC1CN2CCCCC2CN1[C@@H]1CCC[C@H]1O |
| InChI | InChI=1S/C14H26N2O/c1-11-9-15-8-3-2-5-12(15)10-16(11)13-6-4-7-14(13)17/h11-14,17H,2-10H2,1H3/t11?,12?,13-,14-/m1/s1 |
| InChIKey | SNGZBCCNPRISTG-NWINJMCUSA-N |
| XLogP | 1.46 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |