C11H21NO3S — CID 115688453
1,1-dioxo-4-(3-propan-2-ylpyrrolidin-1-yl)thiolan-3-ol (PubChem CID 115688453) has the molecular formula C11H21NO3S and a molecular weight of 247.36 g/mol. Its IUPAC name is 1,1-dioxo-4-(3-propan-2-ylpyrrolidin-1-yl)thiolan-3-ol.
| Compound Name | 1,1-dioxo-4-(3-propan-2-ylpyrrolidin-1-yl)thiolan-3-ol |
|---|---|
| PubChem CID | 115688453 |
| Molecular Formula | C11H21NO3S |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 1,1-dioxo-4-(3-propan-2-ylpyrrolidin-1-yl)thiolan-3-ol |
| SMILES | CC(C)C1CCN(C2CS(=O)(=O)CC2O)C1 |
| InChI | InChI=1S/C11H21NO3S/c1-8(2)9-3-4-12(5-9)10-6-16(14,15)7-11(10)13/h8-11,13H,3-7H2,1-2H3 |
| InChIKey | VLOYHVPGQLJPQN-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |